CAS 232951-82-5 appears in our catalog under these names: Carbonisocyanatidic acid 9h-fluoren-9-ylmethyl ester, 95%, N-FMOC-ISOCYANATE, 95%. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 1g.
9H-fluoren-9-ylmethyl N-(oxomethylidene)carbamate (CAS 232951-82-5) is a chemical compound with the molecular formula C16H11NO3 and a molecular weight of 265.26 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(oxomethylidene)carbamate. InChIKey: SRAHDGNWVCEFKK-UHFFFAOYSA-N.
| Molecular formula | C16H11NO3 |
|---|---|
| Molecular weight | 265.26 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(oxomethylidene)carbamate |
| InChIKey | SRAHDGNWVCEFKK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N=C=O |
Computed by PubChem (NCBI)