2-(Benzyloxy)-5-(trifluoromethyl)aniline, 97%
cas: 117901-14-1 — see every product listed under this CAS number, including other names
2-(Benzyloxy)-5-(trifluoromethyl)aniline, 97% (CAS 117901-14-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A365784-100mg |
| cas | 117901-14-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 987.81 Pln | |
| Ambeed | 5g | 2806.75 Pln | |
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 674.00 Pln | |
| Chemat | 5g | 2594.00 Pln | |
| BLDpharm | 100mg | 264.38 Pln | |
| BLDpharm | 250mg | 403.22 Pln | |
| BLDpharm | 1g | 947.47 Pln | |
| BLDpharm | 5g | 2707.96 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-phenylmethoxy-5-(trifluoromethyl)aniline (CAS 117901-14-1) is a chemical compound with the molecular formula C14H12F3NO and a molecular weight of 267.25 g/mol. IUPAC name: 2-phenylmethoxy-5-(trifluoromethyl)aniline. InChIKey: VKHDZWQPEGTTJC-UHFFFAOYSA-N.
| Molecular formula | C14H12F3NO |
|---|---|
| Molecular weight | 267.25 g/mol |
| IUPAC name | 2-phenylmethoxy-5-(trifluoromethyl)aniline |
| InChIKey | VKHDZWQPEGTTJC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)