CAS 207233-99-6 is the registry number for 2,5-Dimethyl-1-[3-(trifluoromethyl)phenyl]-1h-pyrrole-3-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrole-3-carbaldehyde (CAS 207233-99-6) is a chemical compound with the molecular formula C14H12F3NO and a molecular weight of 267.25 g/mol. IUPAC name: 2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrole-3-carbaldehyde. InChIKey: JHWUPSAKKXZTKT-UHFFFAOYSA-N.
| Molecular formula | C14H12F3NO |
|---|---|
| Molecular weight | 267.25 g/mol |
| IUPAC name | 2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrole-3-carbaldehyde |
| InChIKey | JHWUPSAKKXZTKT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=CC(=C2)C(F)(F)F)C)C=O |
Computed by PubChem (NCBI)