CAS 1044209-50-8 appears in our catalog under these names: 4'-Methoxy-2-(trifluoromethyl)-[1,1'-biphenyl]-4-amine, 95%, 4'-Methoxy-2-(trifluoromethyl)-[1,1'-biphenyl]-4-amine, ≥95%, ≥95%, 4'-Methoxy-2-(trifluoromethyl)biphenyl-4-amine, >=95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g.
4-(4-methoxyphenyl)-3-(trifluoromethyl)aniline (CAS 1044209-50-8) is a chemical compound with the molecular formula C14H12F3NO and a molecular weight of 267.25 g/mol. IUPAC name: 4-(4-methoxyphenyl)-3-(trifluoromethyl)aniline. InChIKey: XHPAVAMAWJIYLS-UHFFFAOYSA-N.
| Molecular formula | C14H12F3NO |
|---|---|
| Molecular weight | 267.25 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)-3-(trifluoromethyl)aniline |
| InChIKey | XHPAVAMAWJIYLS-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C=C(C=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)