CAS 231278-67-4 appears in our catalog under these names: 4-{(3-(Trifluoromethyl)phenyl)methoxy}aniline, 4-([3-(Trifluoromethyl)phenyl]methoxy)aniline, 95%, 4-{(3-(trifluoromethyl)phenyl)methoxy}aniline, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 0,5g, 1g, 10g, 250mg, 100mg.
4-[[3-(trifluoromethyl)phenyl]methoxy]aniline (CAS 231278-67-4) is a chemical compound with the molecular formula C14H12F3NO and a molecular weight of 267.25 g/mol. IUPAC name: 4-[[3-(trifluoromethyl)phenyl]methoxy]aniline. InChIKey: KSVWUYLDKMOEDI-UHFFFAOYSA-N.
| Molecular formula | C14H12F3NO |
|---|---|
| Molecular weight | 267.25 g/mol |
| IUPAC name | 4-[[3-(trifluoromethyl)phenyl]methoxy]aniline |
| InChIKey | KSVWUYLDKMOEDI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)COC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)