CAS 932226-24-9 is the registry number for 2,5-Dimethyl-1-[2-(trifluoromethyl)phenyl]-1H-pyrrole-3-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbaldehyde (CAS 932226-24-9) is a chemical compound with the molecular formula C14H12F3NO and a molecular weight of 267.25 g/mol. IUPAC name: 2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbaldehyde. InChIKey: BPGJTHYIJWQASI-UHFFFAOYSA-N.
| Molecular formula | C14H12F3NO |
|---|---|
| Molecular weight | 267.25 g/mol |
| IUPAC name | 2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbaldehyde |
| InChIKey | BPGJTHYIJWQASI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=CC=C2C(F)(F)F)C)C=O |
Computed by PubChem (NCBI)