CAS 1273815-40-9 is the registry number for Phenyl(2-(trifluoromethoxy)phenyl)methanamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Phenyl-[2-(trifluoromethoxy)phenyl]methanamine (CAS 1273815-40-9) is a chemical compound with the molecular formula C14H12F3NO and a molecular weight of 267.25 g/mol. IUPAC name: phenyl-[2-(trifluoromethoxy)phenyl]methanamine. InChIKey: JPQLKGFRFAHSKP-UHFFFAOYSA-N.
| Molecular formula | C14H12F3NO |
|---|---|
| Molecular weight | 267.25 g/mol |
| IUPAC name | phenyl-[2-(trifluoromethoxy)phenyl]methanamine |
| InChIKey | JPQLKGFRFAHSKP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2OC(F)(F)F)N |
Computed by PubChem (NCBI)