cas: 113439-83-1 — see every product listed under this CAS number, including other names
2-(But-2-yn-1-yl)isoindoline-1,3-dione (CAS 113439-83-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F728307-5G |
| cas | 113439-83-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 685.19 Pln | |
| Fluorochem | 25g | 2830.27 Pln |
| delivery time | 3-4 weeks |
|---|
2-but-2-ynylisoindole-1,3-dione (CAS 113439-83-1) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: 2-but-2-ynylisoindole-1,3-dione. InChIKey: COPWPECHFWIYSP-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 2-but-2-ynylisoindole-1,3-dione |
| InChIKey | COPWPECHFWIYSP-UHFFFAOYSA-N |
| SMILES | CC#CCN1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)