cas: 63878-71-7 — see every product listed under this CAS number, including other names
2-(Difluoromethyl)-1-fluoro-4-nitrobenzene 95% (CAS 63878-71-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A194897-1g |
| cas | 63878-71-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 236.88 Pln | |
| Ambeed | 5g | 642.94 Pln | |
| Ambeed | 25g | 2918.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A194897 |
2-(difluoromethyl)-1-fluoro-4-nitrobenzene (CAS 63878-71-7) is a chemical compound with the molecular formula C7H4F3NO2 and a molecular weight of 191.11 g/mol. IUPAC name: 2-(difluoromethyl)-1-fluoro-4-nitrobenzene. InChIKey: VXIMQWWMIPNFEO-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO2 |
|---|---|
| Molecular weight | 191.11 g/mol |
| IUPAC name | 2-(difluoromethyl)-1-fluoro-4-nitrobenzene |
| InChIKey | VXIMQWWMIPNFEO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(F)F)F |
Computed by PubChem (NCBI)