cas: 1177289-23-4 — see every product listed under this CAS number, including other names
2-(Dimethylamino)pyridine-3-carboxylic acid hydrochloride 95% (CAS 1177289-23-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1107683-100mg |
| cas | 1177289-23-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 492.75 Pln | |
| Ambeed | 250mg | 776.44 Pln | |
| Ambeed | 1g | 1516.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1107683 |
2-(dimethylamino)pyridine-3-carboxylic acid;hydrochloride (CAS 1177289-23-4) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: 2-(dimethylamino)pyridine-3-carboxylic acid;hydrochloride. InChIKey: DYSKZQWSXJTYLG-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 2-(dimethylamino)pyridine-3-carboxylic acid;hydrochloride |
| InChIKey | DYSKZQWSXJTYLG-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=CC=N1)C(=O)O.Cl |
Computed by PubChem (NCBI)