CAS 151509-01-2 appears in our catalog under these names: Methyl 2-(aminomethyl)nicotinate hydrochloride, 95%, Methyl 2-(aminomethyl)nicotinate hydrochloride 97%, Methyl 2-(aminomethyl)nicotinate hydrochloride, 97%, Methyl 2-(aminomethyl)nicotinate hydrochloride, 97%, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 5g, 1g.
Methyl 2-(aminomethyl)pyridine-3-carboxylate;hydrochloride (CAS 151509-01-2) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: methyl 2-(aminomethyl)pyridine-3-carboxylate;hydrochloride. InChIKey: YJQDCBSPMOIYHF-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | methyl 2-(aminomethyl)pyridine-3-carboxylate;hydrochloride |
| InChIKey | YJQDCBSPMOIYHF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=CC=C1)CN.Cl |
Computed by PubChem (NCBI)