Products 1624607-59-5

CAS 1624607-59-5 is the registry number for 3-Amino-4-(methylamino)benzoic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 10g, 1g.

Structural formula: {0} (CAS {1})

3-amino-4-(methylamino)benzoic acid;hydrochloride (CAS 1624607-59-5) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: 3-amino-4-(methylamino)benzoic acid;hydrochloride. InChIKey: PUXWLRFASNWVDY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11ClN2O2
Molecular weight202.64 g/mol
IUPAC name3-amino-4-(methylamino)benzoic acid;hydrochloride
InChIKeyPUXWLRFASNWVDY-UHFFFAOYSA-N
SMILESCNC1=C(C=C(C=C1)C(=O)O)N.Cl

Computed by PubChem (NCBI)