CAS 1177289-23-4 appears in our catalog under these names: 2-(Dimethylamino)pyridine-3-carboxylic acid hydrochloride, 95%, 2-(Dimethylamino)pyridine-3-carboxylic acid hydrochloride, 2-(Dimethylamino)pyridine-3-carboxylic acid hydrochloride 95%, 2-(Dimethylamino)pyridine-3-carboxylic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 250mg, 0,5g.
2-(dimethylamino)pyridine-3-carboxylic acid;hydrochloride (CAS 1177289-23-4) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: 2-(dimethylamino)pyridine-3-carboxylic acid;hydrochloride. InChIKey: DYSKZQWSXJTYLG-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 2-(dimethylamino)pyridine-3-carboxylic acid;hydrochloride |
| InChIKey | DYSKZQWSXJTYLG-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=CC=N1)C(=O)O.Cl |
Computed by PubChem (NCBI)