Products 1177289-23-4

CAS 1177289-23-4 appears in our catalog under these names: 2-(Dimethylamino)pyridine-3-carboxylic acid hydrochloride, 95%, 2-(Dimethylamino)pyridine-3-carboxylic acid hydrochloride, 2-(Dimethylamino)pyridine-3-carboxylic acid hydrochloride 95%, 2-(Dimethylamino)pyridine-3-carboxylic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 250mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(dimethylamino)pyridine-3-carboxylic acid;hydrochloride (CAS 1177289-23-4) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: 2-(dimethylamino)pyridine-3-carboxylic acid;hydrochloride. InChIKey: DYSKZQWSXJTYLG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11ClN2O2
Molecular weight202.64 g/mol
IUPAC name2-(dimethylamino)pyridine-3-carboxylic acid;hydrochloride
InChIKeyDYSKZQWSXJTYLG-UHFFFAOYSA-N
SMILESCN(C)C1=C(C=CC=N1)C(=O)O.Cl

Computed by PubChem (NCBI)