CAS 90389-70-1 appears in our catalog under these names: N-Methyl-n-(3-nitrobenzyl)amine hydrochloride, 95%, Methyl((3-nitrophenyl)methyl)amine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
N-methyl-1-(3-nitrophenyl)methanamine;hydrochloride (CAS 90389-70-1) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: N-methyl-1-(3-nitrophenyl)methanamine;hydrochloride. InChIKey: PBYAYJHCOPZPDI-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | N-methyl-1-(3-nitrophenyl)methanamine;hydrochloride |
| InChIKey | PBYAYJHCOPZPDI-UHFFFAOYSA-N |
| SMILES | CNCC1=CC(=CC=C1)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)