CAS 84139-00-4 appears in our catalog under these names: (2,3-Dihydrobenzo[b][1,4]dioxin-6-yl)hydrazine hydrochloride, 95%, (2,3-Dihydrobenzo(b)(1,4)dioxin-6-yl)hydrazine hydrochloride, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2,3-dihydro-1,4-benzodioxin-6-ylhydrazine;hydrochloride (CAS 84139-00-4) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxin-6-ylhydrazine;hydrochloride. InChIKey: LRTNSVAUVCJCBD-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxin-6-ylhydrazine;hydrochloride |
| InChIKey | LRTNSVAUVCJCBD-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)NN.Cl |
Computed by PubChem (NCBI)