cas: 30777-95-8 — see every product listed under this CAS number, including other names
2-(Pyridin-3-ylmethoxy)isoindoline-1,3-dione, 95%, 95% (CAS 30777-95-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KK0S-1g |
| cas | 30777-95-8 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 280.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(pyridin-3-ylmethoxy)isoindole-1,3-dione (CAS 30777-95-8) is a chemical compound with the molecular formula C14H10N2O3 and a molecular weight of 254.24 g/mol. IUPAC name: 2-(pyridin-3-ylmethoxy)isoindole-1,3-dione. InChIKey: PLNOXXFMIVONEL-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O3 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 2-(pyridin-3-ylmethoxy)isoindole-1,3-dione |
| InChIKey | PLNOXXFMIVONEL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)OCC3=CN=CC=C3 |
Computed by PubChem (NCBI)