Products 955971-69-4

CAS 955971-69-4 is the registry number for 3-(2-Furyl)-1-phenyl-1h-pyrazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-(furan-2-yl)-1-phenylpyrazole-5-carboxylic acid (CAS 955971-69-4) is a chemical compound with the molecular formula C14H10N2O3 and a molecular weight of 254.24 g/mol. IUPAC name: 3-(furan-2-yl)-1-phenylpyrazole-5-carboxylic acid. InChIKey: NQQPNNSSTWGYPK-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10N2O3
Molecular weight254.24 g/mol
IUPAC name3-(furan-2-yl)-1-phenylpyrazole-5-carboxylic acid
InChIKeyNQQPNNSSTWGYPK-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)N2C(=CC(=N2)C3=CC=CO3)C(=O)O

Computed by PubChem (NCBI)