Products 30777-95-8
CAS 30777-95-8 appears in our catalog under these names: 2-(Pyridin-3-ylmethoxy)isoindoline-1,3-dione, 95%, 95%, 1H-Isoindole-1,3(2h)-dione, 2-(3-pyridinylmethoxy)-, 97%, 2–(Pyridin–3–ylmethoxy)isoindoline–1，3–dione. Offered by: Chemat, Combi-blocks, GLPBio. Available pack sizes: 1g, 25g, 250mg, 5g.
2-(pyridin-3-ylmethoxy)isoindole-1,3-dione (CAS 30777-95-8) is a chemical compound with the molecular formula C14H10N2O3 and a molecular weight of 254.24 g/mol. IUPAC name: 2-(pyridin-3-ylmethoxy)isoindole-1,3-dione. InChIKey: PLNOXXFMIVONEL-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O3 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 2-(pyridin-3-ylmethoxy)isoindole-1,3-dione |
| InChIKey | PLNOXXFMIVONEL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)OCC3=CN=CC=C3 |
Computed by PubChem (NCBI)