CAS 923884-15-5 is the registry number for 3-Methyl-6-phenylisoxazolo[5,4-b]pyridine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-methyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid (CAS 923884-15-5) is a chemical compound with the molecular formula C14H10N2O3 and a molecular weight of 254.24 g/mol. IUPAC name: 3-methyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid. InChIKey: NNKBJIAZFVEYII-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O3 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 3-methyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid |
| InChIKey | NNKBJIAZFVEYII-UHFFFAOYSA-N |
| SMILES | CC1=NOC2=C1C(=CC(=N2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)