CAS 1111000-64-6 is the registry number for 2-Methyl-11-oxo-11h-pyrido[2,1-b]quinazoline-6-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-methyl-11-oxopyrido[2,1-b]quinazoline-6-carboxylic acid (CAS 1111000-64-6) is a chemical compound with the molecular formula C14H10N2O3 and a molecular weight of 254.24 g/mol. IUPAC name: 2-methyl-11-oxopyrido[2,1-b]quinazoline-6-carboxylic acid. InChIKey: PULTVJUNVUPMSG-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O3 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 2-methyl-11-oxopyrido[2,1-b]quinazoline-6-carboxylic acid |
| InChIKey | PULTVJUNVUPMSG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C3C(=CC=CN3C2=O)C(=O)O |
Computed by PubChem (NCBI)