CAS 1370418-97-5 is the registry number for 5-Methyl-3-(quinolin-5-yl)isoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-3-quinolin-5-yl-1,2-oxazole-4-carboxylic acid (CAS 1370418-97-5) is a chemical compound with the molecular formula C14H10N2O3 and a molecular weight of 254.24 g/mol. IUPAC name: 5-methyl-3-quinolin-5-yl-1,2-oxazole-4-carboxylic acid. InChIKey: OMMVYWNWCOLAAU-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O3 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 5-methyl-3-quinolin-5-yl-1,2-oxazole-4-carboxylic acid |
| InChIKey | OMMVYWNWCOLAAU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=C3C=CC=NC3=CC=C2)C(=O)O |
Computed by PubChem (NCBI)