cas: 63968-85-4 — see every product listed under this CAS number, including other names
2-(TRIFLUOROMETHOXY)BENZONITRILE, >97%, >97% (CAS 63968-85-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114F6C-1g |
| cas | 63968-85-4 |
| size | 1g |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 122.00 Pln | |
| Chemat | 25g | 194.00 Pln | |
| Chemat | 100g | 606.80 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
2-(trifluoromethoxy)benzonitrile (CAS 63968-85-4) is a chemical compound with the molecular formula C8H4F3NO and a molecular weight of 187.12 g/mol. IUPAC name: 2-(trifluoromethoxy)benzonitrile. InChIKey: ACNBBQGAWMHXLA-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 2-(trifluoromethoxy)benzonitrile |
| InChIKey | ACNBBQGAWMHXLA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)OC(F)(F)F |
Computed by PubChem (NCBI)