cas: 3878-18-0 — see every product listed under this CAS number, including other names
2-(Thiophen-2-yl)-1H-benzo[d]imidazole, 95+%, 95+% (CAS 3878-18-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CJW7-1g |
| cas | 3878-18-0 |
| size | 1g |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 592.40 Pln | |
| Chemat | 5g | 2632.40 Pln | |
| Chemat | 10g | 5176.40 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
2-thiophen-2-yl-1H-benzimidazole (CAS 3878-18-0) is a chemical compound with the molecular formula C11H8N2S and a molecular weight of 200.26 g/mol. IUPAC name: 2-thiophen-2-yl-1H-benzimidazole. InChIKey: XXCGVPNWMZKOER-UHFFFAOYSA-N.
| Molecular formula | C11H8N2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 2-thiophen-2-yl-1H-benzimidazole |
| InChIKey | XXCGVPNWMZKOER-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)C3=CC=CS3 |
Computed by PubChem (NCBI)