cas: 13797-63-2 — see every product listed under this CAS number, including other names
2-(Trifluoromethyl)-3h-imidazo[4,5-b]pyridine, 98%, 98% (CAS 13797-63-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1128RD-100mg |
| cas | 13797-63-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 458.00 Pln | |
| Chemat | 250mg | 784.40 Pln | |
| Chemat | 1g | 1850.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(trifluoromethyl)-1H-imidazo[4,5-b]pyridine (CAS 13797-63-2) is a chemical compound with the molecular formula C7H4F3N3 and a molecular weight of 187.12 g/mol. IUPAC name: 2-(trifluoromethyl)-1H-imidazo[4,5-b]pyridine. InChIKey: ZARGVGOKPZAHDY-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3 |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 2-(trifluoromethyl)-1H-imidazo[4,5-b]pyridine |
| InChIKey | ZARGVGOKPZAHDY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C1)N=C(N2)C(F)(F)F |
Computed by PubChem (NCBI)