CAS 959238-36-9 appears in our catalog under these names: 3-(Trifluoromethyl)imidazo[1,5-a]pyrazine, 95%, 3-(Trifluoromethyl)imidazo(1,5-a)pyrazine, 3-(Trifluoromethyl)Imidazo[1,5-A]Pyrazine, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g, 100mg, 500mg.
3-(trifluoromethyl)imidazo[1,5-a]pyrazine (CAS 959238-36-9) is a chemical compound with the molecular formula C7H4F3N3 and a molecular weight of 187.12 g/mol. IUPAC name: 3-(trifluoromethyl)imidazo[1,5-a]pyrazine. InChIKey: KXHWOUDLBWTSJR-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3 |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 3-(trifluoromethyl)imidazo[1,5-a]pyrazine |
| InChIKey | KXHWOUDLBWTSJR-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=CN=C2C(F)(F)F)C=N1 |
Computed by PubChem (NCBI)