CAS 109113-96-4 is the registry number for 2-(Trifluoromethyl)imidazo[1,2-a]pyrazine, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.
2-(trifluoromethyl)imidazo[1,2-a]pyrazine (CAS 109113-96-4) is a chemical compound with the molecular formula C7H4F3N3 and a molecular weight of 187.12 g/mol. IUPAC name: 2-(trifluoromethyl)imidazo[1,2-a]pyrazine. InChIKey: GZOZMIOBJGXNBA-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3 |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 2-(trifluoromethyl)imidazo[1,2-a]pyrazine |
| InChIKey | GZOZMIOBJGXNBA-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(N=C2C=N1)C(F)(F)F |
Computed by PubChem (NCBI)