cas: 707-72-2 — see every product listed under this CAS number, including other names
2-(Trifluoromethyl)benzal Chloride (CAS 707-72-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g. Offered by: TCI, Fluorochem.
| brand | TCI |
|---|---|
| catalog number | T1305-25G |
| cas | 707-72-2 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 409.95 Pln | |
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 482.14 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
1-(dichloromethyl)-2-(trifluoromethyl)benzene (CAS 707-72-2) is a chemical compound with the molecular formula C8H5Cl2F3 and a molecular weight of 229.02 g/mol. IUPAC name: 1-(dichloromethyl)-2-(trifluoromethyl)benzene. InChIKey: JIJFXGFHPXLJME-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2F3 |
|---|---|
| Molecular weight | 229.02 g/mol |
| IUPAC name | 1-(dichloromethyl)-2-(trifluoromethyl)benzene |
| InChIKey | JIJFXGFHPXLJME-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)