cas: 41840-28-2 — see every product listed under this CAS number, including other names
2-(tert-Butoxycarbonylthio)-4,6-dimethylpyrimidine [Boc Agent for Peptides Synthesis], >98.0%(T) (CAS 41840-28-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B1089-5G |
| cas | 41840-28-2 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 128.18 Pln | |
| TCI | 25g | 437.97 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
Tert-butyl (4,6-dimethylpyrimidin-2-yl)sulfanylformate (CAS 41840-28-2) is a chemical compound with the molecular formula C11H16N2O2S and a molecular weight of 240.32 g/mol. IUPAC name: tert-butyl (4,6-dimethylpyrimidin-2-yl)sulfanylformate. InChIKey: POTDIELOEHTPJN-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2S |
|---|---|
| Molecular weight | 240.32 g/mol |
| IUPAC name | tert-butyl (4,6-dimethylpyrimidin-2-yl)sulfanylformate |
| InChIKey | POTDIELOEHTPJN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)SC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)