cas: 41840-28-2 — see every product listed under this CAS number, including other names
O-tert-Butyl S-(4,6-dimethylpyrimidin-2-yl) carbonothioate, 98%, 98% (CAS 41840-28-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114U8I-1g |
| cas | 41840-28-2 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 160.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (4,6-dimethylpyrimidin-2-yl)sulfanylformate (CAS 41840-28-2) is a chemical compound with the molecular formula C11H16N2O2S and a molecular weight of 240.32 g/mol. IUPAC name: tert-butyl (4,6-dimethylpyrimidin-2-yl)sulfanylformate. InChIKey: POTDIELOEHTPJN-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2S |
|---|---|
| Molecular weight | 240.32 g/mol |
| IUPAC name | tert-butyl (4,6-dimethylpyrimidin-2-yl)sulfanylformate |
| InChIKey | POTDIELOEHTPJN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)SC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)