cas: 53039-62-6 — see every product listed under this CAS number, including other names
2-[(4-Methoxyphenyl)methyl]-1H-1,3-benzodiazole 95% (CAS 53039-62-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1098472-100mg |
| cas | 53039-62-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 364.81 Pln | |
| Ambeed | 1g | 921.06 Pln | |
| Ambeed | 5g | 2545.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1098472 |
2-[(4-methoxyphenyl)methyl]-1H-benzimidazole (CAS 53039-62-6) is a chemical compound with the molecular formula C15H14N2O and a molecular weight of 238.28 g/mol. IUPAC name: 2-[(4-methoxyphenyl)methyl]-1H-benzimidazole. InChIKey: RRZBJTKIOFNONP-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 2-[(4-methoxyphenyl)methyl]-1H-benzimidazole |
| InChIKey | RRZBJTKIOFNONP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CC2=NC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)