cas: 1092977-61-1 — see every product listed under this CAS number, including other names
2-[[2-(3-Butoxyphenyl)ethyl]amino]-N,N-dimethylacetamide, 95%, 95% (CAS 1092977-61-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FPI9-100mg |
| cas | 1092977-61-1 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1442.00 Pln | |
| Chemat | 250mg | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[2-(3-butoxyphenyl)ethylamino]-N,N-dimethylacetamide (CAS 1092977-61-1) is a chemical compound with the molecular formula C16H26N2O2 and a molecular weight of 278.39 g/mol. IUPAC name: 2-[2-(3-butoxyphenyl)ethylamino]-N,N-dimethylacetamide. InChIKey: GRHBODILPPXVKN-UHFFFAOYSA-N.
| Molecular formula | C16H26N2O2 |
|---|---|
| Molecular weight | 278.39 g/mol |
| IUPAC name | 2-[2-(3-butoxyphenyl)ethylamino]-N,N-dimethylacetamide |
| InChIKey | GRHBODILPPXVKN-UHFFFAOYSA-N |
| SMILES | CCCCOC1=CC=CC(=C1)CCNCC(=O)N(C)C |
Computed by PubChem (NCBI)