cas: 1334146-19-8 — see every product listed under this CAS number, including other names
2-AMINO-2-(3-CHLOROPHENYL)ETHANOL HCL, 98% (CAS 1334146-19-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F532943-100MG |
| cas | 1334146-19-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 690.40 Pln | |
| Fluorochem | 250mg | 1002.79 Pln | |
| Fluorochem | 1g | 2002.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-amino-2-(3-chlorophenyl)ethanol;hydrochloride (CAS 1334146-19-8) is a chemical compound with the molecular formula C8H11Cl2NO and a molecular weight of 208.08 g/mol. IUPAC name: 2-amino-2-(3-chlorophenyl)ethanol;hydrochloride. InChIKey: QAYBZIBCNZGNDV-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2NO |
|---|---|
| Molecular weight | 208.08 g/mol |
| IUPAC name | 2-amino-2-(3-chlorophenyl)ethanol;hydrochloride |
| InChIKey | QAYBZIBCNZGNDV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(CO)N.Cl |
Computed by PubChem (NCBI)