cas: 3900-45-6 — see every product listed under this CAS number, including other names
2-Acetyl-6-methoxynaphthalene, >98.0%(GC) (CAS 3900-45-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A2030-25G |
| cas | 3900-45-6 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 113.43 Pln | |
| TCI | 100g | 256.03 Pln | |
| TCI | 500g | 787.09 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1-(6-methoxynaphthalen-2-yl)ethanone (CAS 3900-45-6) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 1-(6-methoxynaphthalen-2-yl)ethanone. InChIKey: GGWCZBGAIGGTDA-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 1-(6-methoxynaphthalen-2-yl)ethanone |
| InChIKey | GGWCZBGAIGGTDA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)C=C(C=C2)OC |
Computed by PubChem (NCBI)