cas: 63788-62-5 — see every product listed under this CAS number, including other names
2-Acetylamino-4-methyl-thiazole-5-carboxylic acid, 95% (CAS 63788-62-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F058243-250MG |
| cas | 63788-62-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 456.11 Pln | |
| Fluorochem | 1g | 1294.35 Pln | |
| Fluorochem | 5g | 5605.34 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-acetamido-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 63788-62-5) is a chemical compound with the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. IUPAC name: 2-acetamido-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: QNBIYKNODXVOFV-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3S |
|---|---|
| Molecular weight | 200.22 g/mol |
| IUPAC name | 2-acetamido-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | QNBIYKNODXVOFV-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC(=O)C)C(=O)O |
Computed by PubChem (NCBI)