cas: 63788-62-5 — see every product listed under this CAS number, including other names
2-Acetylamino-4-methylthiazole-5-carboxylic acid, 97%, 97% (CAS 63788-62-5) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EJ90-1g |
| cas | 63788-62-5 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 928.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-acetamido-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 63788-62-5) is a chemical compound with the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. IUPAC name: 2-acetamido-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: QNBIYKNODXVOFV-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3S |
|---|---|
| Molecular weight | 200.22 g/mol |
| IUPAC name | 2-acetamido-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | QNBIYKNODXVOFV-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC(=O)C)C(=O)O |
Computed by PubChem (NCBI)