cas: 56966-48-4 — see every product listed under this CAS number, including other names
2-Amino-2,4-Dichlorodiphenyl Ether, 95%, 95% (CAS 56966-48-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MLU-1g |
| cas | 56966-48-4 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 371.60 Pln | |
| Chemat | 10g | 683.60 Pln | |
| Chemat | 25g | 1523.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-chloro-2-(2-chlorophenoxy)aniline (CAS 56966-48-4) is a chemical compound with the molecular formula C12H9Cl2NO and a molecular weight of 254.11 g/mol. IUPAC name: 5-chloro-2-(2-chlorophenoxy)aniline. InChIKey: PHORTNLNXNZNET-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO |
|---|---|
| Molecular weight | 254.11 g/mol |
| IUPAC name | 5-chloro-2-(2-chlorophenoxy)aniline |
| InChIKey | PHORTNLNXNZNET-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OC2=C(C=C(C=C2)Cl)N)Cl |
Computed by PubChem (NCBI)