Products 1314987-39-7
CAS 1314987-39-7 is the registry number for 5-(Benzyloxy)-2,3-dichloropyridine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
2,3-dichloro-5-phenylmethoxypyridine (CAS 1314987-39-7) is a chemical compound with the molecular formula C12H9Cl2NO and a molecular weight of 254.11 g/mol. IUPAC name: 2,3-dichloro-5-phenylmethoxypyridine. InChIKey: MBKDILGRPWWOPM-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO |
|---|---|
| Molecular weight | 254.11 g/mol |
| IUPAC name | 2,3-dichloro-5-phenylmethoxypyridine |
| InChIKey | MBKDILGRPWWOPM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(N=C2)Cl)Cl |
Computed by PubChem (NCBI)