Products 1262133-20-9

CAS 1262133-20-9 appears in our catalog under these names: 4-(Benzyloxy)-2,6-dichloropyridine, 95%, 4-(Benzyloxy)-2,6-dichloropyridine. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 100mg.

Structural formula: {0} (CAS {1})

2,6-dichloro-4-phenylmethoxypyridine (CAS 1262133-20-9) is a chemical compound with the molecular formula C12H9Cl2NO and a molecular weight of 254.11 g/mol. IUPAC name: 2,6-dichloro-4-phenylmethoxypyridine. InChIKey: ZQQFOHVNHOYXQN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9Cl2NO
Molecular weight254.11 g/mol
IUPAC name2,6-dichloro-4-phenylmethoxypyridine
InChIKeyZQQFOHVNHOYXQN-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=CC(=NC(=C2)Cl)Cl

Computed by PubChem (NCBI)