Products 402561-69-7
CAS 402561-69-7 is the registry number for (3,5-Dichloropyridin-4-yl)(phenyl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3,5-dichloro-4-pyridinyl)-phenylmethanol (CAS 402561-69-7) is a chemical compound with the molecular formula C12H9Cl2NO and a molecular weight of 254.11 g/mol. IUPAC name: (3,5-dichloro-4-pyridinyl)-phenylmethanol. InChIKey: KYCIZKAWIZEYNS-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO |
|---|---|
| Molecular weight | 254.11 g/mol |
| IUPAC name | (3,5-dichloro-4-pyridinyl)-phenylmethanol |
| InChIKey | KYCIZKAWIZEYNS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=C(C=NC=C2Cl)Cl)O |
Computed by PubChem (NCBI)