CAS 887974-84-7 appears in our catalog under these names: [6-(3,5-Dichlorophenyl)-3-pyridyl]methanol, 95%, (6–(3,5–Dichlorophenyl)–3–pyridyl)methanol. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
[6-(3,5-dichlorophenyl)-3-pyridinyl]methanol (CAS 887974-84-7) is a chemical compound with the molecular formula C12H9Cl2NO and a molecular weight of 254.11 g/mol. IUPAC name: [6-(3,5-dichlorophenyl)-3-pyridinyl]methanol. InChIKey: LMYUDPMZUDMWTI-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO |
|---|---|
| Molecular weight | 254.11 g/mol |
| IUPAC name | [6-(3,5-dichlorophenyl)-3-pyridinyl]methanol |
| InChIKey | LMYUDPMZUDMWTI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1CO)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)