Products 1881295-44-8
CAS 1881295-44-8 appears in our catalog under these names: 2-(benzyloxy)-3,5-dichloropyridine, 95%, 2-(Benzyloxy)-3,5-dichloropyridine, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
3,5-dichloro-2-phenylmethoxypyridine (CAS 1881295-44-8) is a chemical compound with the molecular formula C12H9Cl2NO and a molecular weight of 254.11 g/mol. IUPAC name: 3,5-dichloro-2-phenylmethoxypyridine. InChIKey: FFUPPQRWFBAJLW-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO |
|---|---|
| Molecular weight | 254.11 g/mol |
| IUPAC name | 3,5-dichloro-2-phenylmethoxypyridine |
| InChIKey | FFUPPQRWFBAJLW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=N2)Cl)Cl |
Computed by PubChem (NCBI)