CAS 36765-84-1 appears in our catalog under these names: 3-Nitrophenacylamine hydrochloride, 95%, 3-Nitrophenacylamine hydrochloride/ 98%, 2-Amino-3'-nitroacetophenone hydrochloride, 98% . Offered by: Combi-blocks, Chemat, Thermo Scientific (Alfa Aesar). Available pack sizes: 250mg, 10g, 5g, 1g, 2,5g.
2-amino-1-(3-nitrophenyl)ethanone;hydrochloride (CAS 36765-84-1) is a chemical compound with the molecular formula C8H9ClN2O3 and a molecular weight of 216.62 g/mol. IUPAC name: 2-amino-1-(3-nitrophenyl)ethanone;hydrochloride. InChIKey: BRFUJSROKAAPJT-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O3 |
|---|---|
| Molecular weight | 216.62 g/mol |
| IUPAC name | 2-amino-1-(3-nitrophenyl)ethanone;hydrochloride |
| InChIKey | BRFUJSROKAAPJT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)CN.Cl |
Computed by PubChem (NCBI)