CAS 52977-57-8 is the registry number for 4-(hydrazinecarbonyl)benzoic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-(hydrazinecarbonyl)benzoic acid;hydrochloride (CAS 52977-57-8) is a chemical compound with the molecular formula C8H9ClN2O3 and a molecular weight of 216.62 g/mol. IUPAC name: 4-(hydrazinecarbonyl)benzoic acid;hydrochloride. InChIKey: MSRMJQAPGXQXAY-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O3 |
|---|---|
| Molecular weight | 216.62 g/mol |
| IUPAC name | 4-(hydrazinecarbonyl)benzoic acid;hydrochloride |
| InChIKey | MSRMJQAPGXQXAY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NN)C(=O)O.Cl |
Computed by PubChem (NCBI)