Products 1095270-83-9
CAS 1095270-83-9 appears in our catalog under these names: 6-Nitro-3,4-dihydro-2h-benzo[b][1,4]oxazine hydrochloride, 95%, 6-Nitro-3,4-dihydro-2H-benzo(b)(1,4)oxazine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
6-nitro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride (CAS 1095270-83-9) is a chemical compound with the molecular formula C8H9ClN2O3 and a molecular weight of 216.62 g/mol. IUPAC name: 6-nitro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride. InChIKey: REQSOLQCDRTGDD-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O3 |
|---|---|
| Molecular weight | 216.62 g/mol |
| IUPAC name | 6-nitro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride |
| InChIKey | REQSOLQCDRTGDD-UHFFFAOYSA-N |
| SMILES | C1COC2=C(N1)C=C(C=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)