Products 2089335-11-3
CAS 2089335-11-3 appears in our catalog under these names: 7-Nitro-3,4-dihydro-2h-1,4-benzoxazine hydrochloride, 95%, 7-Nitro-3,4-dihydro-2H-benzo[b][1,4]oxazine hydrochloride 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg.
7-nitro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride (CAS 2089335-11-3) is a chemical compound with the molecular formula C8H9ClN2O3 and a molecular weight of 216.62 g/mol. IUPAC name: 7-nitro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride. InChIKey: WOIPIXQRHBWLQK-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O3 |
|---|---|
| Molecular weight | 216.62 g/mol |
| IUPAC name | 7-nitro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride |
| InChIKey | WOIPIXQRHBWLQK-UHFFFAOYSA-N |
| SMILES | C1COC2=C(N1)C=CC(=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)