CAS 353292-84-9 is the registry number for 2-Chloro-5-[1-(methoxycarbonyl)ethoxy]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-(2-chloropyrimidin-5-yl)oxypropanoate (CAS 353292-84-9) is a chemical compound with the molecular formula C8H9ClN2O3 and a molecular weight of 216.62 g/mol. IUPAC name: methyl 2-(2-chloropyrimidin-5-yl)oxypropanoate. InChIKey: FDGLVALYYVAOPO-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O3 |
|---|---|
| Molecular weight | 216.62 g/mol |
| IUPAC name | methyl 2-(2-chloropyrimidin-5-yl)oxypropanoate |
| InChIKey | FDGLVALYYVAOPO-UHFFFAOYSA-N |
| SMILES | CC(C(=O)OC)OC1=CN=C(N=C1)Cl |
Computed by PubChem (NCBI)