Products 1395035-46-7
CAS 1395035-46-7 appears in our catalog under these names: 5-Chloro-3-nitro-2-(propan-2-yloxy)pyridine, 95%, 5-Chloro-3-nitro-2-(propan-2-yloxy)pyridine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
5-chloro-3-nitro-2-propan-2-yloxypyridine (CAS 1395035-46-7) is a chemical compound with the molecular formula C8H9ClN2O3 and a molecular weight of 216.62 g/mol. IUPAC name: 5-chloro-3-nitro-2-propan-2-yloxypyridine. InChIKey: OSFVACIDCGQNEK-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O3 |
|---|---|
| Molecular weight | 216.62 g/mol |
| IUPAC name | 5-chloro-3-nitro-2-propan-2-yloxypyridine |
| InChIKey | OSFVACIDCGQNEK-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=N1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)