cas: 61858-39-7 — see every product listed under this CAS number, including other names
2-Amino-3’-bromoacetophenone Hydrochloride, 95%, 95% (CAS 61858-39-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GD9-1g |
| cas | 61858-39-7 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-amino-1-(3-bromophenyl)ethanone;hydrochloride (CAS 61858-39-7) is a chemical compound with the molecular formula C8H9BrClNO and a molecular weight of 250.52 g/mol. IUPAC name: 2-amino-1-(3-bromophenyl)ethanone;hydrochloride. InChIKey: UBJDGVBOZSLUCW-UHFFFAOYSA-N.
| Molecular formula | C8H9BrClNO |
|---|---|
| Molecular weight | 250.52 g/mol |
| IUPAC name | 2-amino-1-(3-bromophenyl)ethanone;hydrochloride |
| InChIKey | UBJDGVBOZSLUCW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)CN.Cl |
Computed by PubChem (NCBI)