CAS 1335058-63-3 is the registry number for 5-Bromo-2-chloro-3-isopropoxypyridine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
5-bromo-2-chloro-3-propan-2-yloxypyridine (CAS 1335058-63-3) is a chemical compound with the molecular formula C8H9BrClNO and a molecular weight of 250.52 g/mol. IUPAC name: 5-bromo-2-chloro-3-propan-2-yloxypyridine. InChIKey: QPWDYXIBSFVGIV-UHFFFAOYSA-N.
| Molecular formula | C8H9BrClNO |
|---|---|
| Molecular weight | 250.52 g/mol |
| IUPAC name | 5-bromo-2-chloro-3-propan-2-yloxypyridine |
| InChIKey | QPWDYXIBSFVGIV-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(N=CC(=C1)Br)Cl |
Computed by PubChem (NCBI)