Products 1258400-12-2
CAS 1258400-12-2 appears in our catalog under these names: 7-Bromo-2,3-dihydro-1-benzofuran-3-amine hydrochloride, 95%, 7-Bromo-2,3-dihydrobenzofuran-3-amine Hydrochloride, >97%, >97%, 7-Bromo-2,3-dihydrobenzofuran-3-amine hydrochloride, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
7-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 1258400-12-2) is a chemical compound with the molecular formula C8H9BrClNO and a molecular weight of 250.52 g/mol. IUPAC name: 7-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: IIJLGAROGPJXJC-UHFFFAOYSA-N.
| Molecular formula | C8H9BrClNO |
|---|---|
| Molecular weight | 250.52 g/mol |
| IUPAC name | 7-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | IIJLGAROGPJXJC-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C(=CC=C2)Br)N.Cl |
Computed by PubChem (NCBI)